C19H18F3N — CID 132507787
3-tert-butyl-6-(2,2,2-trifluoroethyl)phenanthridine (PubChem CID 132507787) has the molecular formula C19H18F3N and a molecular weight of 317.35 g/mol. Its IUPAC name is 3-tert-butyl-6-(2,2,2-trifluoroethyl)phenanthridine.
| Compound Name | 3-tert-butyl-6-(2,2,2-trifluoroethyl)phenanthridine |
|---|---|
| PubChem CID | 132507787 |
| Molecular Formula | C19H18F3N |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | 3-tert-butyl-6-(2,2,2-trifluoroethyl)phenanthridine |
| SMILES | CC(C)(C)c1ccc2c(c1)nc(CC(F)(F)F)c1ccccc12 |
| InChI | InChI=1S/C19H18F3N/c1-18(2,3)12-8-9-15-13-6-4-5-7-14(13)17(11-19(20,21)22)23-16(15)10-12/h4-10H,11H2,1-3H3 |
| InChIKey | VQPNZXJVKIDOKN-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|