C21H24O11 — CID 132514063
9-(hydroxymethyl)-9-methyl-2-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]xanthene-1,3,6,7-tetrol (PubChem CID 132514063) has the molecular formula C21H24O11 and a molecular weight of 452.41 g/mol. Its IUPAC name is 9-(hydroxymethyl)-9-methyl-2-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]xanthene-1,3,6,7-tetrol.
| Compound Name | 9-(hydroxymethyl)-9-methyl-2-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]xanthene-1,3,6,7-tetrol |
|---|---|
| PubChem CID | 132514063 |
| Molecular Formula | C21H24O11 |
| Molecular Weight | 452.41 g/mol |
| Exact Mass | 452.13 |
| IUPAC Name | 9-(hydroxymethyl)-9-methyl-2-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]xanthene-1,3,6,7-tetrol |
| SMILES | CC1(CO)c2cc(O)c(O)cc2Oc2cc(O)c([C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c(O)c21 |
| InChI | InChI=1S/C21H24O11/c1-21(6-23)7-2-8(24)9(25)3-11(7)31-12-4-10(26)14(17(28)15(12)21)20-19(30)18(29)16(27)13(5-22)32-20/h2-4,13,16,18-20,22-30H,5-6H2,1H3/t13-,16-,18+,19-,20+,21?/m1/s1 |
| InChIKey | RYVUQFCCCJYREI-QMPIUYLCSA-N |
| XLogP | -0.57 |
| TPSA | 200.53 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.41 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|