C30H48N2O8 — CID 132516848
N-[11-oxo-11-[4-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyanilino]undecyl]cyclohexanecarboxamide (PubChem CID 132516848) has the molecular formula C30H48N2O8 and a molecular weight of 564.72 g/mol. Its IUPAC name is N-[11-oxo-11-[4-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyanilino]undecyl]cyclohexanecarboxamide.
| Compound Name | N-[11-oxo-11-[4-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyanilino]undecyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 132516848 |
| Molecular Formula | C30H48N2O8 |
| Molecular Weight | 564.72 g/mol |
| Exact Mass | 564.34 |
| IUPAC Name | N-[11-oxo-11-[4-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyanilino]undecyl]cyclohexanecarboxamide |
| SMILES | O=C(CCCCCCCCCCNC(=O)C1CCCCC1)Nc1ccc(O[C@@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)cc1 |
| InChI | InChI=1S/C30H48N2O8/c33-20-24-26(35)27(36)28(37)30(40-24)39-23-17-15-22(16-18-23)32-25(34)14-10-5-3-1-2-4-6-11-19-31-29(38)21-12-8-7-9-13-21/h15-18,21,24,26-28,30,33,35-37H,1-14,19-20H2,(H,31,38)(H,32,34)/t24-,26+,27+,28-,30-/m1/s1 |
| InChIKey | AINBBKXGFBOJSK-OROGXDDESA-N |
| XLogP | 3.01 |
| TPSA | 157.58 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.72 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|