C7H2I2N4O4 — CID 132518741
4,7-diiodo-5,6-dinitro-1H-benzimidazole (PubChem CID 132518741) has the molecular formula C7H2I2N4O4 and a molecular weight of 459.93 g/mol. Its IUPAC name is 4,7-diiodo-5,6-dinitro-1H-benzimidazole.
| Compound Name | 4,7-diiodo-5,6-dinitro-1H-benzimidazole |
|---|---|
| PubChem CID | 132518741 |
| Molecular Formula | C7H2I2N4O4 |
| Molecular Weight | 459.93 g/mol |
| Exact Mass | 459.82 |
| IUPAC Name | 4,7-diiodo-5,6-dinitro-1H-benzimidazole |
| SMILES | O=[N+]([O-])c1c([N+](=O)[O-])c(I)c2[nH]cnc2c1I |
| InChI | InChI=1S/C7H2I2N4O4/c8-2-4-5(11-1-10-4)3(9)7(13(16)17)6(2)12(14)15/h1H,(H,10,11) |
| InChIKey | QLYGNVDENYBJLZ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 114.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.93 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|