About 2,12-dithiatricyclo[11.7.0.03,11]icosa-1(13),3(11)-diene
2,12-dithiatricyclo[11.7.0.03,11]icosa-1(13),3(11)-diene (PubChem CID 132519727) has the molecular formula C18H28S2
and a molecular weight of 308.56 g/mol. Its IUPAC name is 2,12-dithiatricyclo[11.7.0.03,11]icosa-1(13),3(11)-diene.
Analyze 2,12-dithiatricyclo[11.7.0.03,11]icosa-1(13),3(11)-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,12-dithiatricyclo[11.7.0.03,11]icosa-1(13),3(11)-diene?
The IUPAC name of 2,12-dithiatricyclo[11.7.0.03,11]icosa-1(13),3(11)-diene (CID 132519727) is 2,12-dithiatricyclo[11.7.0.03,11]icosa-1(13),3(11)-diene.
What is the SMILES notation for 2,12-dithiatricyclo[11.7.0.03,11]icosa-1(13),3(11)-diene?
The canonical SMILES for 2,12-dithiatricyclo[11.7.0.03,11]icosa-1(13),3(11)-diene is C1CCCC2=C(CCC1)SC1=C(CCCCCCC1)S2.
What is the InChIKey of 2,12-dithiatricyclo[11.7.0.03,11]icosa-1(13),3(11)-diene?
The InChIKey is LRHMLHUYPQQDIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H28S2/c1-3-7-11-15-16(12-8-4-1)20-18-14-10-6-2-5-9-13-17(18)19-15/h1-14H2.
What are the key properties of 2,12-dithiatricyclo[11.7.0.03,11]icosa-1(13),3(11)-diene?
2,12-dithiatricyclo[11.7.0.03,11]icosa-1(13),3(11)-diene has a molecular weight of 308.56 g/mol, XLogP of 7.38, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,12-dithiatricyclo[11.7.0.03,11]icosa-1(13),3(11)-diene is sourced from PubChem (CID 132519727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).