About 2,13-dithiatricyclo[12.8.0.03,12]docosa-1(14),3(12)-diene
2,13-dithiatricyclo[12.8.0.03,12]docosa-1(14),3(12)-diene (PubChem CID 134847831) has the molecular formula C20H32S2
and a molecular weight of 336.61 g/mol. Its IUPAC name is 2,13-dithiatricyclo[12.8.0.03,12]docosa-1(14),3(12)-diene.
Analyze 2,13-dithiatricyclo[12.8.0.03,12]docosa-1(14),3(12)-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,13-dithiatricyclo[12.8.0.03,12]docosa-1(14),3(12)-diene?
The IUPAC name of 2,13-dithiatricyclo[12.8.0.03,12]docosa-1(14),3(12)-diene (CID 134847831) is 2,13-dithiatricyclo[12.8.0.03,12]docosa-1(14),3(12)-diene.
What is the SMILES notation for 2,13-dithiatricyclo[12.8.0.03,12]docosa-1(14),3(12)-diene?
The canonical SMILES for 2,13-dithiatricyclo[12.8.0.03,12]docosa-1(14),3(12)-diene is C1CCCCC2=C(CCC1)SC1=C(CCCCCCCC1)S2.
What is the InChIKey of 2,13-dithiatricyclo[12.8.0.03,12]docosa-1(14),3(12)-diene?
The InChIKey is XNSXAQSWWIYVDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H32S2/c1-2-6-10-14-18-17(13-9-5-1)21-19-15-11-7-3-4-8-12-16-20(19)22-18/h1-16H2.
What are the key properties of 2,13-dithiatricyclo[12.8.0.03,12]docosa-1(14),3(12)-diene?
2,13-dithiatricyclo[12.8.0.03,12]docosa-1(14),3(12)-diene has a molecular weight of 336.61 g/mol, XLogP of 8.16, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,13-dithiatricyclo[12.8.0.03,12]docosa-1(14),3(12)-diene is sourced from PubChem (CID 134847831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).