C19H40O4Si2 — CID 132520571
tert-butyl-[[(2R,3R,6S)-3-[tert-butyl(dimethyl)silyl]oxy-6-methoxy-3,6-dihydro-2H-pyran-2-yl]methoxy]-dimethylsilane (PubChem CID 132520571) has the molecular formula C19H40O4Si2 and a molecular weight of 388.70 g/mol. Its IUPAC name is tert-butyl-[[(2R,3R,6S)-3-[tert-butyl(dimethyl)silyl]oxy-6-methoxy-3,6-dihydro-2H-pyran-2-yl]methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(2R,3R,6S)-3-[tert-butyl(dimethyl)silyl]oxy-6-methoxy-3,6-dihydro-2H-pyran-2-yl]methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 132520571 |
| Molecular Formula | C19H40O4Si2 |
| Molecular Weight | 388.70 g/mol |
| Exact Mass | 388.25 |
| IUPAC Name | tert-butyl-[[(2R,3R,6S)-3-[tert-butyl(dimethyl)silyl]oxy-6-methoxy-3,6-dihydro-2H-pyran-2-yl]methoxy]-dimethylsilane |
| SMILES | CO[C@@H]1C=C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C19H40O4Si2/c1-18(2,3)24(8,9)21-14-16-15(12-13-17(20-7)22-16)23-25(10,11)19(4,5)6/h12-13,15-17H,14H2,1-11H3/t15-,16-,17+/m1/s1 |
| InChIKey | FBALCFMXXCLKFC-ZACQAIPSSA-N |
| XLogP | 5.33 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.70 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|