C18H33NO6Si — CID 132521201
tert-butyl (2R,3S,3aR,6aS)-3-[tert-butyl(dimethyl)silyl]oxy-2-(hydroxymethyl)-5-oxo-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]pyrrole-4-carboxylate (PubChem CID 132521201) has the molecular formula C18H33NO6Si and a molecular weight of 387.55 g/mol. Its IUPAC name is tert-butyl (2R,3S,3aR,6aS)-3-[tert-butyl(dimethyl)silyl]oxy-2-(hydroxymethyl)-5-oxo-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]pyrrole-4-carboxylate.
| Compound Name | tert-butyl (2R,3S,3aR,6aS)-3-[tert-butyl(dimethyl)silyl]oxy-2-(hydroxymethyl)-5-oxo-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]pyrrole-4-carboxylate |
|---|---|
| PubChem CID | 132521201 |
| Molecular Formula | C18H33NO6Si |
| Molecular Weight | 387.55 g/mol |
| Exact Mass | 387.21 |
| IUPAC Name | tert-butyl (2R,3S,3aR,6aS)-3-[tert-butyl(dimethyl)silyl]oxy-2-(hydroxymethyl)-5-oxo-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]pyrrole-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(=O)C[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]21 |
| InChI | InChI=1S/C18H33NO6Si/c1-17(2,3)24-16(22)19-13(21)9-11-14(19)15(12(10-20)23-11)25-26(7,8)18(4,5)6/h11-12,14-15,20H,9-10H2,1-8H3/t11-,12+,14+,15+/m0/s1 |
| InChIKey | YABOCLPEQYGDCK-CTHBEMJXSA-N |
| XLogP | 2.67 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.55 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|