C18H33NO8Si — CID 15175417
tert-butyl (2R,3S,4S)-2-[(S)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-trimethylsilyloxymethyl]-3,4-dihydroxy-5-oxopyrrolidine-1-carboxylate (PubChem CID 15175417) has the molecular formula C18H33NO8Si and a molecular weight of 419.55 g/mol. Its IUPAC name is tert-butyl (2R,3S,4S)-2-[(S)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-trimethylsilyloxymethyl]-3,4-dihydroxy-5-oxopyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R,3S,4S)-2-[(S)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-trimethylsilyloxymethyl]-3,4-dihydroxy-5-oxopyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 15175417 |
| Molecular Formula | C18H33NO8Si |
| Molecular Weight | 419.55 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | tert-butyl (2R,3S,4S)-2-[(S)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-trimethylsilyloxymethyl]-3,4-dihydroxy-5-oxopyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(=O)[C@@H](O)[C@@H](O)[C@@H]1[C@H](O[Si](C)(C)C)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C18H33NO8Si/c1-17(2,3)26-16(23)19-11(12(20)13(21)15(19)22)14(27-28(6,7)8)10-9-24-18(4,5)25-10/h10-14,20-21H,9H2,1-8H3/t10-,11-,12+,13+,14-/m1/s1 |
| InChIKey | FSMLFVOLTFOGQA-PEBLQZBPSA-N |
| XLogP | 1.23 |
| TPSA | 114.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.55 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|