C21H30N2O5 — CID 132521202
tert-butyl (2S,3R,3aS,6aS)-3-acetamido-2-(phenylmethoxymethyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-4-carboxylate (PubChem CID 132521202) has the molecular formula C21H30N2O5 and a molecular weight of 390.48 g/mol. Its IUPAC name is tert-butyl (2S,3R,3aS,6aS)-3-acetamido-2-(phenylmethoxymethyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-4-carboxylate.
| Compound Name | tert-butyl (2S,3R,3aS,6aS)-3-acetamido-2-(phenylmethoxymethyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-4-carboxylate |
|---|---|
| PubChem CID | 132521202 |
| Molecular Formula | C21H30N2O5 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | tert-butyl (2S,3R,3aS,6aS)-3-acetamido-2-(phenylmethoxymethyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-4-carboxylate |
| SMILES | CC(=O)N[C@@H]1[C@H]2[C@H](CCN2C(=O)OC(C)(C)C)O[C@@H]1COCc1ccccc1 |
| InChI | InChI=1S/C21H30N2O5/c1-14(24)22-18-17(13-26-12-15-8-6-5-7-9-15)27-16-10-11-23(19(16)18)20(25)28-21(2,3)4/h5-9,16-19H,10-13H2,1-4H3,(H,22,24)/t16-,17+,18-,19+/m0/s1 |
| InChIKey | HGKHUKLGEBWXLF-ZSYWTGECSA-N |
| XLogP | 2.48 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |