C20H33N3 — CID 132521315
(5S,6S,12S,15S,19R,20S,22S)-1,11,21-triazahexacyclo[17.3.1.05,22.06,11.012,21.015,20]tricosane (PubChem CID 132521315) has the molecular formula C20H33N3 and a molecular weight of 315.51 g/mol. Its IUPAC name is (5S,6S,12S,15S,19R,20S,22S)-1,11,21-triazahexacyclo[17.3.1.05,22.06,11.012,21.015,20]tricosane.
| Compound Name | (5S,6S,12S,15S,19R,20S,22S)-1,11,21-triazahexacyclo[17.3.1.05,22.06,11.012,21.015,20]tricosane |
|---|---|
| PubChem CID | 132521315 |
| Molecular Formula | C20H33N3 |
| Molecular Weight | 315.51 g/mol |
| Exact Mass | 315.27 |
| IUPAC Name | (5S,6S,12S,15S,19R,20S,22S)-1,11,21-triazahexacyclo[17.3.1.05,22.06,11.012,21.015,20]tricosane |
| SMILES | C1C[C@H]2CC[C@H]3N4CCCC[C@H]4[C@@H]4CCCN5C[C@@H](C1)[C@H]2N3[C@@H]45 |
| InChI | InChI=1S/C20H33N3/c1-2-12-22-17(8-1)16-7-4-11-21-13-15-6-3-5-14-9-10-18(22)23(19(14)15)20(16)21/h14-20H,1-13H2/t14-,15+,16-,17-,18-,19-,20-/m0/s1 |
| InChIKey | IFCLIVLOEBMYOU-DTMQFJJTSA-N |
| XLogP | 3.11 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.51 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |