C30H35NO5S — CID 132521821
tert-butyl (1S,3S,3aS,8aS)-3a-acetyl-3-(2-methylphenyl)-2-(4-methylphenyl)sulfonyl-1,3,8,8a-tetrahydrocyclohepta[c]pyrrole-1-carboxylate (PubChem CID 132521821) has the molecular formula C30H35NO5S and a molecular weight of 521.68 g/mol. Its IUPAC name is tert-butyl (1S,3S,3aS,8aS)-3a-acetyl-3-(2-methylphenyl)-2-(4-methylphenyl)sulfonyl-1,3,8,8a-tetrahydrocyclohepta[c]pyrrole-1-carboxylate.
| Compound Name | tert-butyl (1S,3S,3aS,8aS)-3a-acetyl-3-(2-methylphenyl)-2-(4-methylphenyl)sulfonyl-1,3,8,8a-tetrahydrocyclohepta[c]pyrrole-1-carboxylate |
|---|---|
| PubChem CID | 132521821 |
| Molecular Formula | C30H35NO5S |
| Molecular Weight | 521.68 g/mol |
| Exact Mass | 521.22 |
| IUPAC Name | tert-butyl (1S,3S,3aS,8aS)-3a-acetyl-3-(2-methylphenyl)-2-(4-methylphenyl)sulfonyl-1,3,8,8a-tetrahydrocyclohepta[c]pyrrole-1-carboxylate |
| SMILES | CC(=O)[C@@]12C=CC=CC[C@@H]1[C@@H](C(=O)OC(C)(C)C)N(S(=O)(=O)c1ccc(C)cc1)[C@H]2c1ccccc1C |
| InChI | InChI=1S/C30H35NO5S/c1-20-15-17-23(18-16-20)37(34,35)31-26(28(33)36-29(4,5)6)25-14-8-7-11-19-30(25,22(3)32)27(31)24-13-10-9-12-21(24)2/h7-13,15-19,25-27H,14H2,1-6H3/t25-,26+,27+,30+/m1/s1 |
| InChIKey | VZGLULAJIOMGPD-VEAWFHDZSA-N |
| XLogP | 5.47 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.68 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |