C24H33NO — CID 132522153
1-(1,2-diphenylpropoxy)-2,2,6,6-tetramethylpiperidine (PubChem CID 132522153) has the molecular formula C24H33NO and a molecular weight of 351.53 g/mol. Its IUPAC name is 1-(1,2-diphenylpropoxy)-2,2,6,6-tetramethylpiperidine.
| Compound Name | 1-(1,2-diphenylpropoxy)-2,2,6,6-tetramethylpiperidine |
|---|---|
| PubChem CID | 132522153 |
| Molecular Formula | C24H33NO |
| Molecular Weight | 351.53 g/mol |
| Exact Mass | 351.26 |
| IUPAC Name | 1-(1,2-diphenylpropoxy)-2,2,6,6-tetramethylpiperidine |
| SMILES | CC(c1ccccc1)C(ON1C(C)(C)CCCC1(C)C)c1ccccc1 |
| InChI | InChI=1S/C24H33NO/c1-19(20-13-8-6-9-14-20)22(21-15-10-7-11-16-21)26-25-23(2,3)17-12-18-24(25,4)5/h6-11,13-16,19,22H,12,17-18H2,1-5H3 |
| InChIKey | QRUAUZUXFZAVGG-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.53 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |