C28H25NO4S2Se — CID 132522180
N-(benzenesulfonyl)-N-[(E)-1-(2,4-dimethylphenyl)-2-phenylselanylethenyl]benzenesulfonamide (PubChem CID 132522180) has the molecular formula C28H25NO4S2Se and a molecular weight of 582.61 g/mol. Its IUPAC name is N-(benzenesulfonyl)-N-[(E)-1-(2,4-dimethylphenyl)-2-phenylselanylethenyl]benzenesulfonamide.
| Compound Name | N-(benzenesulfonyl)-N-[(E)-1-(2,4-dimethylphenyl)-2-phenylselanylethenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 132522180 |
| Molecular Formula | C28H25NO4S2Se |
| Molecular Weight | 582.61 g/mol |
| Exact Mass | 583.04 |
| IUPAC Name | N-(benzenesulfonyl)-N-[(E)-1-(2,4-dimethylphenyl)-2-phenylselanylethenyl]benzenesulfonamide |
| SMILES | Cc1ccc(/C(=C\[Se]c2ccccc2)N(S(=O)(=O)c2ccccc2)S(=O)(=O)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C28H25NO4S2Se/c1-22-18-19-27(23(2)20-22)28(21-36-26-16-10-5-11-17-26)29(34(30,31)24-12-6-3-7-13-24)35(32,33)25-14-8-4-9-15-25/h3-21H,1-2H3/b28-21+ |
| InChIKey | FZLKQUMWHWIZGG-SGWCAAJKSA-N |
| XLogP | 4.71 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.61 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|