C27H33NO4 — CID 132524619
5-[(2E)-3,7-dimethylocta-2,6-dienyl]-4-hydroxy-2-[2-(4-hydroxyphenyl)ethyl]-6-methoxy-3H-isoindol-1-one (PubChem CID 132524619) has the molecular formula C27H33NO4 and a molecular weight of 435.56 g/mol. Its IUPAC name is 5-[(2E)-3,7-dimethylocta-2,6-dienyl]-4-hydroxy-2-[2-(4-hydroxyphenyl)ethyl]-6-methoxy-3H-isoindol-1-one.
| Compound Name | 5-[(2E)-3,7-dimethylocta-2,6-dienyl]-4-hydroxy-2-[2-(4-hydroxyphenyl)ethyl]-6-methoxy-3H-isoindol-1-one |
|---|---|
| PubChem CID | 132524619 |
| Molecular Formula | C27H33NO4 |
| Molecular Weight | 435.56 g/mol |
| Exact Mass | 435.24 |
| IUPAC Name | 5-[(2E)-3,7-dimethylocta-2,6-dienyl]-4-hydroxy-2-[2-(4-hydroxyphenyl)ethyl]-6-methoxy-3H-isoindol-1-one |
| SMILES | COc1cc2c(c(O)c1C/C=C(\C)CCC=C(C)C)CN(CCc1ccc(O)cc1)C2=O |
| InChI | InChI=1S/C27H33NO4/c1-18(2)6-5-7-19(3)8-13-22-25(32-4)16-23-24(26(22)30)17-28(27(23)31)15-14-20-9-11-21(29)12-10-20/h6,8-12,16,29-30H,5,7,13-15,17H2,1-4H3/b19-8+ |
| InChIKey | FLSSXXIBSVDSKS-UFWORHAWSA-N |
| XLogP | 5.54 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.56 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|