C20H19N3O3 — CID 132524784
3-(4-diazo-3-oxobutan-2-yl)-2-[(4-methoxyphenyl)methyl]-3H-isoindol-1-one (PubChem CID 132524784) has the molecular formula C20H19N3O3 and a molecular weight of 349.39 g/mol. Its IUPAC name is 3-(4-diazo-3-oxobutan-2-yl)-2-[(4-methoxyphenyl)methyl]-3H-isoindol-1-one.
| Compound Name | 3-(4-diazo-3-oxobutan-2-yl)-2-[(4-methoxyphenyl)methyl]-3H-isoindol-1-one |
|---|---|
| PubChem CID | 132524784 |
| Molecular Formula | C20H19N3O3 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | 3-(4-diazo-3-oxobutan-2-yl)-2-[(4-methoxyphenyl)methyl]-3H-isoindol-1-one |
| SMILES | COc1ccc(CN2C(=O)c3ccccc3C2C(C)C(=O)C=[N+]=[N-])cc1 |
| InChI | InChI=1S/C20H19N3O3/c1-13(18(24)11-22-21)19-16-5-3-4-6-17(16)20(25)23(19)12-14-7-9-15(26-2)10-8-14/h3-11,13,19H,12H2,1-2H3 |
| InChIKey | SRFUPAZMZRSNJY-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 83.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|