About (2-iodo-3,3-diphenylprop-2-enyl) thiocyanate
(2-iodo-3,3-diphenylprop-2-enyl) thiocyanate (PubChem CID 132524799) has the molecular formula C16H12INS
and a molecular weight of 377.25 g/mol. Its IUPAC name is (2-iodo-3,3-diphenylprop-2-enyl) thiocyanate.
Molecular Properties
| Compound Name | (2-iodo-3,3-diphenylprop-2-enyl) thiocyanate |
| PubChem CID | 132524799 |
| Molecular Formula | C16H12INS |
| Molecular Weight | 377.25 g/mol |
| Exact Mass | 376.97 |
| IUPAC Name | (2-iodo-3,3-diphenylprop-2-enyl) thiocyanate |
| SMILES | N#CSCC(I)=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H12INS/c17-15(11-19-12-18)16(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-10H,11H2 |
| InChIKey | SFRZZBMQOJTAAN-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 377.25 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (2-iodo-3,3-diphenylprop-2-enyl) thiocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-iodo-3,3-diphenylprop-2-enyl) thiocyanate?
The IUPAC name of (2-iodo-3,3-diphenylprop-2-enyl) thiocyanate (CID 132524799) is (2-iodo-3,3-diphenylprop-2-enyl) thiocyanate.
What is the SMILES notation for (2-iodo-3,3-diphenylprop-2-enyl) thiocyanate?
The canonical SMILES for (2-iodo-3,3-diphenylprop-2-enyl) thiocyanate is N#CSCC(I)=C(c1ccccc1)c1ccccc1.
What is the InChIKey of (2-iodo-3,3-diphenylprop-2-enyl) thiocyanate?
The InChIKey is SFRZZBMQOJTAAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12INS/c17-15(11-19-12-18)16(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-10H,11H2.
What are the key properties of (2-iodo-3,3-diphenylprop-2-enyl) thiocyanate?
(2-iodo-3,3-diphenylprop-2-enyl) thiocyanate has a molecular weight of 377.25 g/mol, XLogP of 5.10, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-iodo-3,3-diphenylprop-2-enyl) thiocyanate is sourced from PubChem (CID 132524799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).