C13H17ClN2O8S — CID 132526042
1-(4-chlorophenyl)sulfonyl-3-[(2R,3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]urea (PubChem CID 132526042) has the molecular formula C13H17ClN2O8S and a molecular weight of 396.81 g/mol. Its IUPAC name is 1-(4-chlorophenyl)sulfonyl-3-[(2R,3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]urea.
| Compound Name | 1-(4-chlorophenyl)sulfonyl-3-[(2R,3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]urea |
|---|---|
| PubChem CID | 132526042 |
| Molecular Formula | C13H17ClN2O8S |
| Molecular Weight | 396.81 g/mol |
| Exact Mass | 396.04 |
| IUPAC Name | 1-(4-chlorophenyl)sulfonyl-3-[(2R,3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]urea |
| SMILES | O=C(N[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@H]1O)NS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H17ClN2O8S/c14-6-1-3-7(4-2-6)25(22,23)16-13(21)15-9-11(19)10(18)8(5-17)24-12(9)20/h1-4,8-12,17-20H,5H2,(H2,15,16,21)/t8-,9-,10-,11-,12-/m1/s1 |
| InChIKey | AHCRJHFHJNPBSL-LZQZFOIKSA-N |
| XLogP | -1.87 |
| TPSA | 165.42 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.81 |
| LogP ≤ 5 | -1.87 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |