C26H27FN2O10S — CID 132529414
triethyl 5-fluoro-1-(4-methylphenyl)sulfonyl-3-(4-nitrophenyl)-3H-pyrrole-2,2,4-tricarboxylate (PubChem CID 132529414) has the molecular formula C26H27FN2O10S and a molecular weight of 578.57 g/mol. Its IUPAC name is triethyl 5-fluoro-1-(4-methylphenyl)sulfonyl-3-(4-nitrophenyl)-3H-pyrrole-2,2,4-tricarboxylate.
| Compound Name | triethyl 5-fluoro-1-(4-methylphenyl)sulfonyl-3-(4-nitrophenyl)-3H-pyrrole-2,2,4-tricarboxylate |
|---|---|
| PubChem CID | 132529414 |
| Molecular Formula | C26H27FN2O10S |
| Molecular Weight | 578.57 g/mol |
| Exact Mass | 578.14 |
| IUPAC Name | triethyl 5-fluoro-1-(4-methylphenyl)sulfonyl-3-(4-nitrophenyl)-3H-pyrrole-2,2,4-tricarboxylate |
| SMILES | CCOC(=O)C1=C(F)N(S(=O)(=O)c2ccc(C)cc2)C(C(=O)OCC)(C(=O)OCC)C1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C26H27FN2O10S/c1-5-37-23(30)20-21(17-10-12-18(13-11-17)29(33)34)26(24(31)38-6-2,25(32)39-7-3)28(22(20)27)40(35,36)19-14-8-16(4)9-15-19/h8-15,21H,5-7H2,1-4H3 |
| InChIKey | PEKURUAINJAWHE-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 159.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.57 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|