C37H34N4O7 — CID 132529468
4-[1-[2-(dicyanomethylidene)-7-(diethylamino)chromen-4-yl]ethoxy]-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxobutanoic acid (PubChem CID 132529468) has the molecular formula C37H34N4O7 and a molecular weight of 646.70 g/mol. Its IUPAC name is 4-[1-[2-(dicyanomethylidene)-7-(diethylamino)chromen-4-yl]ethoxy]-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxobutanoic acid.
| Compound Name | 4-[1-[2-(dicyanomethylidene)-7-(diethylamino)chromen-4-yl]ethoxy]-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 132529468 |
| Molecular Formula | C37H34N4O7 |
| Molecular Weight | 646.70 g/mol |
| Exact Mass | 646.24 |
| IUPAC Name | 4-[1-[2-(dicyanomethylidene)-7-(diethylamino)chromen-4-yl]ethoxy]-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxobutanoic acid |
| SMILES | CCN(CC)c1ccc2c(c1)OC(=C(C#N)C#N)C=C2C(C)OC(=O)CC(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O |
| InChI | InChI=1S/C37H34N4O7/c1-4-41(5-2)24-14-15-29-30(17-33(23(19-38)20-39)48-34(29)16-24)22(3)47-35(42)18-32(36(43)44)40-37(45)46-21-31-27-12-8-6-10-25(27)26-11-7-9-13-28(26)31/h6-17,22,31-32H,4-5,18,21H2,1-3H3,(H,40,45)(H,43,44) |
| InChIKey | JZPPJGHGXPMSPS-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 161.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.70 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|