C28H28N2 — CID 132529632
3-[2-(4-tert-butylphenyl)-1-(1H-indol-3-yl)ethyl]-1H-indole (PubChem CID 132529632) has the molecular formula C28H28N2 and a molecular weight of 392.55 g/mol. Its IUPAC name is 3-[2-(4-tert-butylphenyl)-1-(1H-indol-3-yl)ethyl]-1H-indole.
| Compound Name | 3-[2-(4-tert-butylphenyl)-1-(1H-indol-3-yl)ethyl]-1H-indole |
|---|---|
| PubChem CID | 132529632 |
| Molecular Formula | C28H28N2 |
| Molecular Weight | 392.55 g/mol |
| Exact Mass | 392.23 |
| IUPAC Name | 3-[2-(4-tert-butylphenyl)-1-(1H-indol-3-yl)ethyl]-1H-indole |
| SMILES | CC(C)(C)c1ccc(CC(c2c[nH]c3ccccc23)c2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C28H28N2/c1-28(2,3)20-14-12-19(13-15-20)16-23(24-17-29-26-10-6-4-8-21(24)26)25-18-30-27-11-7-5-9-22(25)27/h4-15,17-18,23,29-30H,16H2,1-3H3 |
| InChIKey | BXTASRXPEZNEFP-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 31.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.55 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |