C24H24N2O4 — CID 132530308
ethyl (2R,3S)-3-methyl-4-oxo-2-[2-oxo-2-(1-phenylimidazol-2-yl)ethyl]-3-phenylbutanoate (PubChem CID 132530308) has the molecular formula C24H24N2O4 and a molecular weight of 404.47 g/mol. Its IUPAC name is ethyl (2R,3S)-3-methyl-4-oxo-2-[2-oxo-2-(1-phenylimidazol-2-yl)ethyl]-3-phenylbutanoate.
| Compound Name | ethyl (2R,3S)-3-methyl-4-oxo-2-[2-oxo-2-(1-phenylimidazol-2-yl)ethyl]-3-phenylbutanoate |
|---|---|
| PubChem CID | 132530308 |
| Molecular Formula | C24H24N2O4 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | ethyl (2R,3S)-3-methyl-4-oxo-2-[2-oxo-2-(1-phenylimidazol-2-yl)ethyl]-3-phenylbutanoate |
| SMILES | CCOC(=O)[C@H](CC(=O)c1nccn1-c1ccccc1)[C@](C)(C=O)c1ccccc1 |
| InChI | InChI=1S/C24H24N2O4/c1-3-30-23(29)20(24(2,17-27)18-10-6-4-7-11-18)16-21(28)22-25-14-15-26(22)19-12-8-5-9-13-19/h4-15,17,20H,3,16H2,1-2H3/t20-,24+/m0/s1 |
| InChIKey | OTPQYRUPKSKTCV-GBXCKJPGSA-N |
| XLogP | 3.78 |
| TPSA | 78.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|