C20H20N2O — CID 162408817
(3R)-3-methyl-4-phenyl-1-(1-phenylimidazol-2-yl)butan-1-one (PubChem CID 162408817) has the molecular formula C20H20N2O and a molecular weight of 304.39 g/mol. Its IUPAC name is (3R)-3-methyl-4-phenyl-1-(1-phenylimidazol-2-yl)butan-1-one.
| Compound Name | (3R)-3-methyl-4-phenyl-1-(1-phenylimidazol-2-yl)butan-1-one |
|---|---|
| PubChem CID | 162408817 |
| Molecular Formula | C20H20N2O |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | (3R)-3-methyl-4-phenyl-1-(1-phenylimidazol-2-yl)butan-1-one |
| SMILES | C[C@@H](CC(=O)c1nccn1-c1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C20H20N2O/c1-16(14-17-8-4-2-5-9-17)15-19(23)20-21-12-13-22(20)18-10-6-3-7-11-18/h2-13,16H,14-15H2,1H3/t16-/m1/s1 |
| InChIKey | HRWRKUDWXPNLAQ-MRXNPFEDSA-N |
| XLogP | 4.32 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |