C27H25N3O4 — CID 138973768
methyl N-[1-(4-methoxyphenyl)-3-oxo-3-(1-phenylimidazol-2-yl)propyl]-N-phenylcarbamate (PubChem CID 138973768) has the molecular formula C27H25N3O4 and a molecular weight of 455.51 g/mol. Its IUPAC name is methyl N-[1-(4-methoxyphenyl)-3-oxo-3-(1-phenylimidazol-2-yl)propyl]-N-phenylcarbamate.
| Compound Name | methyl N-[1-(4-methoxyphenyl)-3-oxo-3-(1-phenylimidazol-2-yl)propyl]-N-phenylcarbamate |
|---|---|
| PubChem CID | 138973768 |
| Molecular Formula | C27H25N3O4 |
| Molecular Weight | 455.51 g/mol |
| Exact Mass | 455.18 |
| IUPAC Name | methyl N-[1-(4-methoxyphenyl)-3-oxo-3-(1-phenylimidazol-2-yl)propyl]-N-phenylcarbamate |
| SMILES | COC(=O)N(c1ccccc1)C(CC(=O)c1nccn1-c1ccccc1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C27H25N3O4/c1-33-23-15-13-20(14-16-23)24(30(27(32)34-2)22-11-7-4-8-12-22)19-25(31)26-28-17-18-29(26)21-9-5-3-6-10-21/h3-18,24H,19H2,1-2H3 |
| InChIKey | PGDPBOKNFOZZGJ-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.51 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |