C16H23NO5S3 — CID 132530367
2-[(2-ethoxy-3,4-dioxocyclobuten-1-yl)amino]ethyl 2-butylsulfanylcarbothioylsulfanylpropanoate (PubChem CID 132530367) has the molecular formula C16H23NO5S3 and a molecular weight of 405.56 g/mol. Its IUPAC name is 2-[(2-ethoxy-3,4-dioxocyclobuten-1-yl)amino]ethyl 2-butylsulfanylcarbothioylsulfanylpropanoate.
| Compound Name | 2-[(2-ethoxy-3,4-dioxocyclobuten-1-yl)amino]ethyl 2-butylsulfanylcarbothioylsulfanylpropanoate |
|---|---|
| PubChem CID | 132530367 |
| Molecular Formula | C16H23NO5S3 |
| Molecular Weight | 405.56 g/mol |
| Exact Mass | 405.07 |
| IUPAC Name | 2-[(2-ethoxy-3,4-dioxocyclobuten-1-yl)amino]ethyl 2-butylsulfanylcarbothioylsulfanylpropanoate |
| SMILES | CCCCSC(=S)SC(C)C(=O)OCCNc1c(OCC)c(=O)c1=O |
| InChI | InChI=1S/C16H23NO5S3/c1-4-6-9-24-16(23)25-10(3)15(20)22-8-7-17-11-12(18)13(19)14(11)21-5-2/h10,17H,4-9H2,1-3H3 |
| InChIKey | QLVDDLVMUSOTOW-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.56 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|