C16H22O6S — CID 132531054
ethyl 2-methyl-3-oxo-2-(2,4,6-trimethylphenyl)sulfonyloxybutanoate (PubChem CID 132531054) has the molecular formula C16H22O6S and a molecular weight of 342.41 g/mol. Its IUPAC name is ethyl 2-methyl-3-oxo-2-(2,4,6-trimethylphenyl)sulfonyloxybutanoate.
| Compound Name | ethyl 2-methyl-3-oxo-2-(2,4,6-trimethylphenyl)sulfonyloxybutanoate |
|---|---|
| PubChem CID | 132531054 |
| Molecular Formula | C16H22O6S |
| Molecular Weight | 342.41 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | ethyl 2-methyl-3-oxo-2-(2,4,6-trimethylphenyl)sulfonyloxybutanoate |
| SMILES | CCOC(=O)C(C)(OS(=O)(=O)c1c(C)cc(C)cc1C)C(C)=O |
| InChI | InChI=1S/C16H22O6S/c1-7-21-15(18)16(6,13(5)17)22-23(19,20)14-11(3)8-10(2)9-12(14)4/h8-9H,7H2,1-6H3 |
| InChIKey | UULGDLSJTHLGSP-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.41 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|