C15H12F5N3O — CID 132531268
4,4,5,5,5-pentafluoro-1-phenyl-3-(pyrazin-2-ylamino)pentan-1-one (PubChem CID 132531268) has the molecular formula C15H12F5N3O and a molecular weight of 345.27 g/mol. Its IUPAC name is 4,4,5,5,5-pentafluoro-1-phenyl-3-(pyrazin-2-ylamino)pentan-1-one.
| Compound Name | 4,4,5,5,5-pentafluoro-1-phenyl-3-(pyrazin-2-ylamino)pentan-1-one |
|---|---|
| PubChem CID | 132531268 |
| Molecular Formula | C15H12F5N3O |
| Molecular Weight | 345.27 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | 4,4,5,5,5-pentafluoro-1-phenyl-3-(pyrazin-2-ylamino)pentan-1-one |
| SMILES | O=C(CC(Nc1cnccn1)C(F)(F)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C15H12F5N3O/c16-14(17,15(18,19)20)12(23-13-9-21-6-7-22-13)8-11(24)10-4-2-1-3-5-10/h1-7,9,12H,8H2,(H,22,23) |
| InChIKey | IMHQUIKEPDHXKK-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.27 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|