C24H34O7 — CID 132532223
(3S,8R,9S,10S,11R,13R,14S,16S,17R)-3,11,14,16-tetrahydroxy-13-methyl-17-[(3R)-6-oxooxan-3-yl]-1,2,3,6,7,8,9,11,12,15,16,17-dodecahydrocyclopenta[a]phenanthrene-10-carbaldehyde (PubChem CID 132532223) has the molecular formula C24H34O7 and a molecular weight of 434.53 g/mol. Its IUPAC name is (3S,8R,9S,10S,11R,13R,14S,16S,17R)-3,11,14,16-tetrahydroxy-13-methyl-17-[(3R)-6-oxooxan-3-yl]-1,2,3,6,7,8,9,11,12,15,16,17-dodecahydrocyclopenta[a]phenanthrene-10-carbaldehyde.
| Compound Name | (3S,8R,9S,10S,11R,13R,14S,16S,17R)-3,11,14,16-tetrahydroxy-13-methyl-17-[(3R)-6-oxooxan-3-yl]-1,2,3,6,7,8,9,11,12,15,16,17-dodecahydrocyclopenta[a]phenanthrene-10-carbaldehyde |
|---|---|
| PubChem CID | 132532223 |
| Molecular Formula | C24H34O7 |
| Molecular Weight | 434.53 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | (3S,8R,9S,10S,11R,13R,14S,16S,17R)-3,11,14,16-tetrahydroxy-13-methyl-17-[(3R)-6-oxooxan-3-yl]-1,2,3,6,7,8,9,11,12,15,16,17-dodecahydrocyclopenta[a]phenanthrene-10-carbaldehyde |
| SMILES | C[C@]12C[C@@H](O)[C@H]3[C@@H](CCC4=C[C@@H](O)CC[C@@]43C=O)[C@@]1(O)C[C@H](O)[C@@H]2[C@H]1CCC(=O)OC1 |
| InChI | InChI=1S/C24H34O7/c1-22-9-17(27)21-16(4-3-14-8-15(26)6-7-23(14,21)12-25)24(22,30)10-18(28)20(22)13-2-5-19(29)31-11-13/h8,12-13,15-18,20-21,26-28,30H,2-7,9-11H2,1H3/t13-,15-,16+,17+,18-,20-,21+,22+,23+,24-/m0/s1 |
| InChIKey | XMVUXWFWNHIWSG-SQINYQTPSA-N |
| XLogP | 1.12 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.53 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|