C24H30O6 — CID 162899354
(3R,8S,9S,10S,13R,14S,16S,17R)-3,14,16-trihydroxy-13-methyl-17-(6-oxopyran-3-yl)-1,2,3,6,7,8,9,11,12,15,16,17-dodecahydrocyclopenta[a]phenanthrene-10-carbaldehyde (PubChem CID 162899354) has the molecular formula C24H30O6 and a molecular weight of 414.50 g/mol. Its IUPAC name is (3R,8S,9S,10S,13R,14S,16S,17R)-3,14,16-trihydroxy-13-methyl-17-(6-oxopyran-3-yl)-1,2,3,6,7,8,9,11,12,15,16,17-dodecahydrocyclopenta[a]phenanthrene-10-carbaldehyde.
| Compound Name | (3R,8S,9S,10S,13R,14S,16S,17R)-3,14,16-trihydroxy-13-methyl-17-(6-oxopyran-3-yl)-1,2,3,6,7,8,9,11,12,15,16,17-dodecahydrocyclopenta[a]phenanthrene-10-carbaldehyde |
|---|---|
| PubChem CID | 162899354 |
| Molecular Formula | C24H30O6 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | (3R,8S,9S,10S,13R,14S,16S,17R)-3,14,16-trihydroxy-13-methyl-17-(6-oxopyran-3-yl)-1,2,3,6,7,8,9,11,12,15,16,17-dodecahydrocyclopenta[a]phenanthrene-10-carbaldehyde |
| SMILES | C[C@]12CC[C@H]3[C@H](CCC4=C[C@H](O)CC[C@@]43C=O)[C@@]1(O)C[C@H](O)[C@@H]2c1ccc(=O)oc1 |
| InChI | InChI=1S/C24H30O6/c1-22-8-7-17-18(4-3-15-10-16(26)6-9-23(15,17)13-25)24(22,29)11-19(27)21(22)14-2-5-20(28)30-12-14/h2,5,10,12-13,16-19,21,26-27,29H,3-4,6-9,11H2,1H3/t16-,17+,18+,19+,21+,22-,23-,24+/m1/s1 |
| InChIKey | ZYCHLXSYANWBQR-YGLGQQESSA-N |
| XLogP | 2.31 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|