C23H30O5 — CID 57363650
4-[(8R,9S,13R,14R)-11,14-dihydroxy-3-methoxy-13-methyl-7,8,9,11,12,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-17-yl]oxolan-2-one (PubChem CID 57363650) has the molecular formula C23H30O5 and a molecular weight of 386.49 g/mol. Its IUPAC name is 4-[(8R,9S,13R,14R)-11,14-dihydroxy-3-methoxy-13-methyl-7,8,9,11,12,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-17-yl]oxolan-2-one.
| Compound Name | 4-[(8R,9S,13R,14R)-11,14-dihydroxy-3-methoxy-13-methyl-7,8,9,11,12,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-17-yl]oxolan-2-one |
|---|---|
| PubChem CID | 57363650 |
| Molecular Formula | C23H30O5 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | 4-[(8R,9S,13R,14R)-11,14-dihydroxy-3-methoxy-13-methyl-7,8,9,11,12,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-17-yl]oxolan-2-one |
| SMILES | COc1ccc2c(c1)CC[C@@H]1[C@@H]2C(O)C[C@]2(C)C(C3COC(=O)C3)CC[C@@]12O |
| InChI | InChI=1S/C23H30O5/c1-22-11-19(24)21-16-5-4-15(27-2)9-13(16)3-6-18(21)23(22,26)8-7-17(22)14-10-20(25)28-12-14/h4-5,9,14,17-19,21,24,26H,3,6-8,10-12H2,1-2H3/t14?,17?,18-,19?,21-,22-,23-/m1/s1 |
| InChIKey | SSHFCBKXXAGKEJ-YRCHSAAWSA-N |
| XLogP | 2.82 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |