C35H41N2OP — CID 132534118
N-(2-diphenylphosphorylphenyl)-N'-[2,6-di(propan-2-yl)phenyl]-2,2-dimethylpropanimidamide (PubChem CID 132534118) has the molecular formula C35H41N2OP and a molecular weight of 536.70 g/mol. Its IUPAC name is N-(2-diphenylphosphorylphenyl)-N'-[2,6-di(propan-2-yl)phenyl]-2,2-dimethylpropanimidamide.
| Compound Name | N-(2-diphenylphosphorylphenyl)-N'-[2,6-di(propan-2-yl)phenyl]-2,2-dimethylpropanimidamide |
|---|---|
| PubChem CID | 132534118 |
| Molecular Formula | C35H41N2OP |
| Molecular Weight | 536.70 g/mol |
| Exact Mass | 536.30 |
| IUPAC Name | N-(2-diphenylphosphorylphenyl)-N'-[2,6-di(propan-2-yl)phenyl]-2,2-dimethylpropanimidamide |
| SMILES | CC(C)c1cccc(C(C)C)c1/N=C(/Nc1ccccc1P(=O)(c1ccccc1)c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C35H41N2OP/c1-25(2)29-21-16-22-30(26(3)4)33(29)37-34(35(5,6)7)36-31-23-14-15-24-32(31)39(38,27-17-10-8-11-18-27)28-19-12-9-13-20-28/h8-26H,1-7H3,(H,36,37) |
| InChIKey | RTACJJIGROGNIY-UHFFFAOYSA-N |
| XLogP | 8.76 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.70 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|