C17H8Br3NO2 — CID 132534180
9-amino-6,8,10-tribromobenzo[a]xanthen-5-one (PubChem CID 132534180) has the molecular formula C17H8Br3NO2 and a molecular weight of 497.97 g/mol. Its IUPAC name is 9-amino-6,8,10-tribromobenzo[a]xanthen-5-one.
| Compound Name | 9-amino-6,8,10-tribromobenzo[a]xanthen-5-one |
|---|---|
| PubChem CID | 132534180 |
| Molecular Formula | C17H8Br3NO2 |
| Molecular Weight | 497.97 g/mol |
| Exact Mass | 494.81 |
| IUPAC Name | 9-amino-6,8,10-tribromobenzo[a]xanthen-5-one |
| SMILES | Nc1c(Br)cc2cc3c4ccccc4c(=O)c(Br)c-3oc2c1Br |
| InChI | InChI=1S/C17H8Br3NO2/c18-11-6-7-5-10-8-3-1-2-4-9(8)15(22)13(20)17(10)23-16(7)12(19)14(11)21/h1-6H,21H2 |
| InChIKey | YUBQPFKIKZGXJI-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 56.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.97 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|