C15H10Br2N2O — CID 166439878
3-amino-2-(2,4-dibromophenyl)-1H-quinolin-4-one (PubChem CID 166439878) has the molecular formula C15H10Br2N2O and a molecular weight of 394.07 g/mol. Its IUPAC name is 3-amino-2-(2,4-dibromophenyl)-1H-quinolin-4-one.
| Compound Name | 3-amino-2-(2,4-dibromophenyl)-1H-quinolin-4-one |
|---|---|
| PubChem CID | 166439878 |
| Molecular Formula | C15H10Br2N2O |
| Molecular Weight | 394.07 g/mol |
| Exact Mass | 391.92 |
| IUPAC Name | 3-amino-2-(2,4-dibromophenyl)-1H-quinolin-4-one |
| SMILES | Nc1c(-c2ccc(Br)cc2Br)[nH]c2ccccc2c1=O |
| InChI | InChI=1S/C15H10Br2N2O/c16-8-5-6-9(11(17)7-8)14-13(18)15(20)10-3-1-2-4-12(10)19-14/h1-7H,18H2,(H,19,20) |
| InChIKey | VDKQWENVQQOHCK-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 58.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.07 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |