C11H8ClFN2OS — CID 132534872
2-chloro-2-fluoro-N-(2-phenyl-1,3-thiazol-5-yl)acetamide (PubChem CID 132534872) has the molecular formula C11H8ClFN2OS and a molecular weight of 270.72 g/mol. Its IUPAC name is 2-chloro-2-fluoro-N-(2-phenyl-1,3-thiazol-5-yl)acetamide.
| Compound Name | 2-chloro-2-fluoro-N-(2-phenyl-1,3-thiazol-5-yl)acetamide |
|---|---|
| PubChem CID | 132534872 |
| Molecular Formula | C11H8ClFN2OS |
| Molecular Weight | 270.72 g/mol |
| Exact Mass | 270.00 |
| IUPAC Name | 2-chloro-2-fluoro-N-(2-phenyl-1,3-thiazol-5-yl)acetamide |
| SMILES | O=C(Nc1cnc(-c2ccccc2)s1)C(F)Cl |
| InChI | InChI=1S/C11H8ClFN2OS/c12-9(13)10(16)15-8-6-14-11(17-8)7-4-2-1-3-5-7/h1-6,9H,(H,15,16) |
| InChIKey | AYJVBHHBWXNKQA-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.72 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|