C22H14F2N2 — CID 132535021
5,6-bis(4-fluorophenyl)-3-methyl-2,11-diazatricyclo[5.3.1.04,11]undeca-1(10),2,4,6,8-pentaene (PubChem CID 132535021) has the molecular formula C22H14F2N2 and a molecular weight of 344.36 g/mol. Its IUPAC name is 5,6-bis(4-fluorophenyl)-3-methyl-2,11-diazatricyclo[5.3.1.04,11]undeca-1(10),2,4,6,8-pentaene.
| Compound Name | 5,6-bis(4-fluorophenyl)-3-methyl-2,11-diazatricyclo[5.3.1.04,11]undeca-1(10),2,4,6,8-pentaene |
|---|---|
| PubChem CID | 132535021 |
| Molecular Formula | C22H14F2N2 |
| Molecular Weight | 344.36 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | 5,6-bis(4-fluorophenyl)-3-methyl-2,11-diazatricyclo[5.3.1.04,11]undeca-1(10),2,4,6,8-pentaene |
| SMILES | Cc1nc2cccc3c(-c4ccc(F)cc4)c(-c4ccc(F)cc4)c1n23 |
| InChI | InChI=1S/C22H14F2N2/c1-13-22-21(15-7-11-17(24)12-8-15)20(14-5-9-16(23)10-6-14)18-3-2-4-19(25-13)26(18)22/h2-12H,1H3 |
| InChIKey | AASGIVKSBIWQFG-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.36 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |