C24H18O3 — CID 132535386
(4R)-4-(2-hydroxyphenyl)spiro[oxolane-5,2'-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaene]-2-one (PubChem CID 132535386) has the molecular formula C24H18O3 and a molecular weight of 354.41 g/mol. Its IUPAC name is (4R)-4-(2-hydroxyphenyl)spiro[oxolane-5,2'-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaene]-2-one.
| Compound Name | (4R)-4-(2-hydroxyphenyl)spiro[oxolane-5,2'-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaene]-2-one |
|---|---|
| PubChem CID | 132535386 |
| Molecular Formula | C24H18O3 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | (4R)-4-(2-hydroxyphenyl)spiro[oxolane-5,2'-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaene]-2-one |
| SMILES | O=C1C[C@H](c2ccccc2O)C2(O1)c1ccccc1C=Cc1ccccc12 |
| InChI | InChI=1S/C24H18O3/c25-22-12-6-3-9-18(22)21-15-23(26)27-24(21)19-10-4-1-7-16(19)13-14-17-8-2-5-11-20(17)24/h1-14,21,25H,15H2/t21-/m1/s1 |
| InChIKey | ISFWPXPOCNXRON-OAQYLSRUSA-N |
| XLogP | 4.85 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|