C14H18O2Si — CID 10800462
1-methyl-1-trimethylsilyloxynaphthalen-2-one (PubChem CID 10800462) has the molecular formula C14H18O2Si and a molecular weight of 246.38 g/mol. Its IUPAC name is 1-methyl-1-trimethylsilyloxynaphthalen-2-one.
| Compound Name | 1-methyl-1-trimethylsilyloxynaphthalen-2-one |
|---|---|
| PubChem CID | 10800462 |
| Molecular Formula | C14H18O2Si |
| Molecular Weight | 246.38 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | 1-methyl-1-trimethylsilyloxynaphthalen-2-one |
| SMILES | CC1(O[Si](C)(C)C)C(=O)C=Cc2ccccc21 |
| InChI | InChI=1S/C14H18O2Si/c1-14(16-17(2,3)4)12-8-6-5-7-11(12)9-10-13(14)15/h5-10H,1-4H3 |
| InChIKey | NRFHHTNWLIQUGU-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.38 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|