C14H12O3 — CID 603721
3'-acetyl-3'-methylspiro[naphthalene-1,2'-oxirane]-2-one (PubChem CID 603721) has the molecular formula C14H12O3 and a molecular weight of 228.25 g/mol. Its IUPAC name is 3'-acetyl-3'-methylspiro[naphthalene-1,2'-oxirane]-2-one.
| Compound Name | 3'-acetyl-3'-methylspiro[naphthalene-1,2'-oxirane]-2-one |
|---|---|
| PubChem CID | 603721 |
| Molecular Formula | C14H12O3 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.08 |
| IUPAC Name | 3'-acetyl-3'-methylspiro[naphthalene-1,2'-oxirane]-2-one |
| SMILES | CC(=O)C1(C)OC12C(=O)C=Cc1ccccc12 |
| InChI | InChI=1S/C14H12O3/c1-9(15)13(2)14(17-13)11-6-4-3-5-10(11)7-8-12(14)16/h3-8H,1-2H3 |
| InChIKey | RYQVPNYYLXBCST-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 46.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|