C23H31NOSi — CID 91247385
ethane;(2-isocyano-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenyl)oxy-trimethylsilane (PubChem CID 91247385) has the molecular formula C23H31NOSi and a molecular weight of 365.59 g/mol. Its IUPAC name is ethane;(2-isocyano-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenyl)oxy-trimethylsilane.
| Compound Name | ethane;(2-isocyano-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenyl)oxy-trimethylsilane |
|---|---|
| PubChem CID | 91247385 |
| Molecular Formula | C23H31NOSi |
| Molecular Weight | 365.59 g/mol |
| Exact Mass | 365.22 |
| IUPAC Name | ethane;(2-isocyano-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenyl)oxy-trimethylsilane |
| SMILES | CC.CC.[C-]#[N+]C1(O[Si](C)(C)C)c2ccccc2C=Cc2ccccc21 |
| InChI | InChI=1S/C19H19NOSi.2C2H6/c1-20-19(21-22(2,3)4)17-11-7-5-9-15(17)13-14-16-10-6-8-12-18(16)19;2*1-2/h5-14H,2-4H3;2*1-2H3 |
| InChIKey | ANJHMNIJLWSISD-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 13.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.59 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|