C17H17N — CID 134967547
(11aR)-11a-methyl-7,8,9,10-tetrahydrobenzo[a]carbazole (PubChem CID 134967547) has the molecular formula C17H17N and a molecular weight of 235.33 g/mol. Its IUPAC name is (11aR)-11a-methyl-7,8,9,10-tetrahydrobenzo[a]carbazole.
| Compound Name | (11aR)-11a-methyl-7,8,9,10-tetrahydrobenzo[a]carbazole |
|---|---|
| PubChem CID | 134967547 |
| Molecular Formula | C17H17N |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | (11aR)-11a-methyl-7,8,9,10-tetrahydrobenzo[a]carbazole |
| SMILES | C[C@]12N=C3CCCCC3=C1C=Cc1ccccc12 |
| InChI | InChI=1S/C17H17N/c1-17-14-8-4-2-6-12(14)10-11-15(17)13-7-3-5-9-16(13)18-17/h2,4,6,8,10-11H,3,5,7,9H2,1H3/t17-/m1/s1 |
| InChIKey | CSVYHFKPZQENQP-QGZVFWFLSA-N |
| XLogP | 4.25 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |