C12H12 — CID 142093034
7b-methyl-1,1a-dihydrocyclopropa[a]naphthalene (PubChem CID 142093034) has the molecular formula C12H12 and a molecular weight of 156.23 g/mol. Its IUPAC name is 7b-methyl-1,1a-dihydrocyclopropa[a]naphthalene.
| Compound Name | 7b-methyl-1,1a-dihydrocyclopropa[a]naphthalene |
|---|---|
| PubChem CID | 142093034 |
| Molecular Formula | C12H12 |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.09 |
| IUPAC Name | 7b-methyl-1,1a-dihydrocyclopropa[a]naphthalene |
| SMILES | CC12CC1C=Cc1ccccc12 |
| InChI | InChI=1S/C12H12/c1-12-8-10(12)7-6-9-4-2-3-5-11(9)12/h2-7,10H,8H2,1H3 |
| InChIKey | QYJKWQXVLHKLAK-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |