C14H16O — CID 11138116
(1S,2S)-2-ethyl-1-methyl-2H-naphthalene-1-carbaldehyde (PubChem CID 11138116) has the molecular formula C14H16O and a molecular weight of 200.28 g/mol. Its IUPAC name is (1S,2S)-2-ethyl-1-methyl-2H-naphthalene-1-carbaldehyde.
| Compound Name | (1S,2S)-2-ethyl-1-methyl-2H-naphthalene-1-carbaldehyde |
|---|---|
| PubChem CID | 11138116 |
| Molecular Formula | C14H16O |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | (1S,2S)-2-ethyl-1-methyl-2H-naphthalene-1-carbaldehyde |
| SMILES | CC[C@H]1C=Cc2ccccc2[C@@]1(C)C=O |
| InChI | InChI=1S/C14H16O/c1-3-12-9-8-11-6-4-5-7-13(11)14(12,2)10-15/h4-10,12H,3H2,1-2H3/t12-,14-/m0/s1 |
| InChIKey | XRSFDIFLLQRMEK-JSGCOSHPSA-N |
| XLogP | 3.20 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|