About 2-ethyl-2H-thiochromene
2-ethyl-2H-thiochromene (PubChem CID 123384261) has the molecular formula C11H12S
and a molecular weight of 176.28 g/mol. Its IUPAC name is 2-ethyl-2H-thiochromene.
Molecular Properties
| Compound Name | 2-ethyl-2H-thiochromene |
| PubChem CID | 123384261 |
| Molecular Formula | C11H12S |
| Molecular Weight | 176.28 g/mol |
| Exact Mass | 176.07 |
| IUPAC Name | 2-ethyl-2H-thiochromene |
| SMILES | CCC1C=Cc2ccccc2S1 |
| InChI | InChI=1S/C11H12S/c1-2-10-8-7-9-5-3-4-6-11(9)12-10/h3-8,10H,2H2,1H3 |
| InChIKey | AJJQTVAQBIWHPP-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.28 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-ethyl-2H-thiochromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-2H-thiochromene?
The IUPAC name of 2-ethyl-2H-thiochromene (CID 123384261) is 2-ethyl-2H-thiochromene.
What is the SMILES notation for 2-ethyl-2H-thiochromene?
The canonical SMILES for 2-ethyl-2H-thiochromene is CCC1C=Cc2ccccc2S1.
What is the InChIKey of 2-ethyl-2H-thiochromene?
The InChIKey is AJJQTVAQBIWHPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12S/c1-2-10-8-7-9-5-3-4-6-11(9)12-10/h3-8,10H,2H2,1H3.
What are the key properties of 2-ethyl-2H-thiochromene?
2-ethyl-2H-thiochromene has a molecular weight of 176.28 g/mol, XLogP of 3.58, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-2H-thiochromene is sourced from PubChem (CID 123384261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).