About lithium;1,2-benzothiazepine;hydroxide
lithium;1,2-benzothiazepine;hydroxide (PubChem CID 157392864) has the molecular formula C9H8LiNOS
and a molecular weight of 185.18 g/mol. Its IUPAC name is lithium;1,2-benzothiazepine;hydroxide.
Molecular Properties
| Compound Name | lithium;1,2-benzothiazepine;hydroxide |
| PubChem CID | 157392864 |
| Molecular Formula | C9H8LiNOS |
| Molecular Weight | 185.18 g/mol |
| Exact Mass | 185.05 |
| IUPAC Name | lithium;1,2-benzothiazepine;hydroxide |
| SMILES | C1=Cc2ccccc2SN=C1.[Li+].[OH-] |
| InChI | InChI=1S/C9H7NS.Li.H2O/c1-2-6-9-8(4-1)5-3-7-10-11-9;;/h1-7H;;1H2/q;+1;/p-1 |
| InChIKey | BMFFWWKMYNKECV-UHFFFAOYSA-M |
| XLogP | -0.38 |
| TPSA | 42.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.18 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze lithium;1,2-benzothiazepine;hydroxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;1,2-benzothiazepine;hydroxide?
The IUPAC name of lithium;1,2-benzothiazepine;hydroxide (CID 157392864) is lithium;1,2-benzothiazepine;hydroxide.
What is the SMILES notation for lithium;1,2-benzothiazepine;hydroxide?
The canonical SMILES for lithium;1,2-benzothiazepine;hydroxide is C1=Cc2ccccc2SN=C1.[Li+].[OH-].
What is the InChIKey of lithium;1,2-benzothiazepine;hydroxide?
The InChIKey is BMFFWWKMYNKECV-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H7NS.Li.H2O/c1-2-6-9-8(4-1)5-3-7-10-11-9;;/h1-7H;;1H2/q;+1;/p-1.
What are the key properties of lithium;1,2-benzothiazepine;hydroxide?
lithium;1,2-benzothiazepine;hydroxide has a molecular weight of 185.18 g/mol, XLogP of -0.38, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;1,2-benzothiazepine;hydroxide is sourced from PubChem (CID 157392864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).