C9H8AuN2 — CID 159730285
1H-1,2-benzodiazepine;gold (PubChem CID 159730285) has the molecular formula C9H8AuN2 and a molecular weight of 341.14 g/mol. Its IUPAC name is 1H-1,2-benzodiazepine;gold.
| Compound Name | 1H-1,2-benzodiazepine;gold |
|---|---|
| PubChem CID | 159730285 |
| Molecular Formula | C9H8AuN2 |
| Molecular Weight | 341.14 g/mol |
| Exact Mass | 341.04 |
| IUPAC Name | 1H-1,2-benzodiazepine;gold |
| SMILES | C1=Cc2ccccc2NN=C1.[Au] |
| InChI | InChI=1S/C9H8N2.Au/c1-2-6-9-8(4-1)5-3-7-10-11-9;/h1-7,11H; |
| InChIKey | NBDQVCXGJPYKPG-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.14 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |