C10H11NS — CID 139715140
2-methyl-2,3-dihydro-1,4-benzothiazepine (PubChem CID 139715140) has the molecular formula C10H11NS and a molecular weight of 177.27 g/mol. Its IUPAC name is 2-methyl-2,3-dihydro-1,4-benzothiazepine.
| Compound Name | 2-methyl-2,3-dihydro-1,4-benzothiazepine |
|---|---|
| PubChem CID | 139715140 |
| Molecular Formula | C10H11NS |
| Molecular Weight | 177.27 g/mol |
| Exact Mass | 177.06 |
| IUPAC Name | 2-methyl-2,3-dihydro-1,4-benzothiazepine |
| SMILES | CC1CN=Cc2ccccc2S1 |
| InChI | InChI=1S/C10H11NS/c1-8-6-11-7-9-4-2-3-5-10(9)12-8/h2-5,7-8H,6H2,1H3 |
| InChIKey | ZCGGLDDCUVLJEN-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.27 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |