About 6-ethyl-4-phenyl-3,4-dihydroisoquinoline
6-ethyl-4-phenyl-3,4-dihydroisoquinoline (PubChem CID 175689448) has the molecular formula C17H17N
and a molecular weight of 235.33 g/mol. Its IUPAC name is 6-ethyl-4-phenyl-3,4-dihydroisoquinoline.
Molecular Properties
| Compound Name | 6-ethyl-4-phenyl-3,4-dihydroisoquinoline |
| PubChem CID | 175689448 |
| Molecular Formula | C17H17N |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | 6-ethyl-4-phenyl-3,4-dihydroisoquinoline |
| SMILES | CCc1ccc2c(c1)C(c1ccccc1)CN=C2 |
| InChI | InChI=1S/C17H17N/c1-2-13-8-9-15-11-18-12-17(16(15)10-13)14-6-4-3-5-7-14/h3-11,17H,2,12H2,1H3 |
| InChIKey | LHDOXNOPRZCRPL-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-ethyl-4-phenyl-3,4-dihydroisoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethyl-4-phenyl-3,4-dihydroisoquinoline?
The IUPAC name of 6-ethyl-4-phenyl-3,4-dihydroisoquinoline (CID 175689448) is 6-ethyl-4-phenyl-3,4-dihydroisoquinoline.
What is the SMILES notation for 6-ethyl-4-phenyl-3,4-dihydroisoquinoline?
The canonical SMILES for 6-ethyl-4-phenyl-3,4-dihydroisoquinoline is CCc1ccc2c(c1)C(c1ccccc1)CN=C2.
What is the InChIKey of 6-ethyl-4-phenyl-3,4-dihydroisoquinoline?
The InChIKey is LHDOXNOPRZCRPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17N/c1-2-13-8-9-15-11-18-12-17(16(15)10-13)14-6-4-3-5-7-14/h3-11,17H,2,12H2,1H3.
What are the key properties of 6-ethyl-4-phenyl-3,4-dihydroisoquinoline?
6-ethyl-4-phenyl-3,4-dihydroisoquinoline has a molecular weight of 235.33 g/mol, XLogP of 3.81, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethyl-4-phenyl-3,4-dihydroisoquinoline is sourced from PubChem (CID 175689448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).