C17H17N — CID 175689448
6-ethyl-4-phenyl-3,4-dihydroisoquinoline (PubChem CID 175689448) has the molecular formula C17H17N and a molecular weight of 235.33 g/mol. Its IUPAC name is 6-ethyl-4-phenyl-3,4-dihydroisoquinoline.
| Compound Name | 6-ethyl-4-phenyl-3,4-dihydroisoquinoline |
|---|---|
| PubChem CID | 175689448 |
| Molecular Formula | C17H17N |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | 6-ethyl-4-phenyl-3,4-dihydroisoquinoline |
| SMILES | CCc1ccc2c(c1)C(c1ccccc1)CN=C2 |
| InChI | InChI=1S/C17H17N/c1-2-13-8-9-15-11-18-12-17(16(15)10-13)14-6-4-3-5-7-14/h3-11,17H,2,12H2,1H3 |
| InChIKey | LHDOXNOPRZCRPL-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |