C22H25NO — CID 139949801
2-[2-[4-(dimethylamino)phenyl]ethenyl]-1-ethyl-2H-naphthalen-1-ol (PubChem CID 139949801) has the molecular formula C22H25NO and a molecular weight of 319.45 g/mol. Its IUPAC name is 2-[2-[4-(dimethylamino)phenyl]ethenyl]-1-ethyl-2H-naphthalen-1-ol.
| Compound Name | 2-[2-[4-(dimethylamino)phenyl]ethenyl]-1-ethyl-2H-naphthalen-1-ol |
|---|---|
| PubChem CID | 139949801 |
| Molecular Formula | C22H25NO |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | 2-[2-[4-(dimethylamino)phenyl]ethenyl]-1-ethyl-2H-naphthalen-1-ol |
| SMILES | CCC1(O)c2ccccc2C=CC1C=Cc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C22H25NO/c1-4-22(24)19(14-12-18-7-5-6-8-21(18)22)13-9-17-10-15-20(16-11-17)23(2)3/h5-16,19,24H,4H2,1-3H3 |
| InChIKey | KLPCSOAKYPSJFE-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|