C26H26N2O3S — CID 175300636
4-[2-[4-(dimethylamino)phenyl]ethenyl]-2-methyl-2-naphthalen-1-ylpyridine-1-sulfonic acid (PubChem CID 175300636) has the molecular formula C26H26N2O3S and a molecular weight of 446.57 g/mol. Its IUPAC name is 4-[2-[4-(dimethylamino)phenyl]ethenyl]-2-methyl-2-naphthalen-1-ylpyridine-1-sulfonic acid.
| Compound Name | 4-[2-[4-(dimethylamino)phenyl]ethenyl]-2-methyl-2-naphthalen-1-ylpyridine-1-sulfonic acid |
|---|---|
| PubChem CID | 175300636 |
| Molecular Formula | C26H26N2O3S |
| Molecular Weight | 446.57 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | 4-[2-[4-(dimethylamino)phenyl]ethenyl]-2-methyl-2-naphthalen-1-ylpyridine-1-sulfonic acid |
| SMILES | CN(C)c1ccc(C=CC2=CC(C)(c3cccc4ccccc34)N(S(=O)(=O)O)C=C2)cc1 |
| InChI | InChI=1S/C26H26N2O3S/c1-26(25-10-6-8-22-7-4-5-9-24(22)25)19-21(17-18-28(26)32(29,30)31)12-11-20-13-15-23(16-14-20)27(2)3/h4-19H,1-3H3,(H,29,30,31) |
| InChIKey | WXHZZOHVEKJSKJ-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.57 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|