C26H26N2O2 — CID 68570092
15-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]-16,16-dimethyl-14-oxa-11-azatetracyclo[8.6.0.02,7.011,15]hexadeca-1(10),2,4,6,8-pentaen-13-one (PubChem CID 68570092) has the molecular formula C26H26N2O2 and a molecular weight of 398.51 g/mol. Its IUPAC name is 15-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]-16,16-dimethyl-14-oxa-11-azatetracyclo[8.6.0.02,7.011,15]hexadeca-1(10),2,4,6,8-pentaen-13-one.
| Compound Name | 15-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]-16,16-dimethyl-14-oxa-11-azatetracyclo[8.6.0.02,7.011,15]hexadeca-1(10),2,4,6,8-pentaen-13-one |
|---|---|
| PubChem CID | 68570092 |
| Molecular Formula | C26H26N2O2 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | 15-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]-16,16-dimethyl-14-oxa-11-azatetracyclo[8.6.0.02,7.011,15]hexadeca-1(10),2,4,6,8-pentaen-13-one |
| SMILES | CN(C)c1ccc(/C=C/C23OC(=O)CN2c2ccc4ccccc4c2C3(C)C)cc1 |
| InChI | InChI=1S/C26H26N2O2/c1-25(2)24-21-8-6-5-7-19(21)11-14-22(24)28-17-23(29)30-26(25,28)16-15-18-9-12-20(13-10-18)27(3)4/h5-16H,17H2,1-4H3/b16-15+ |
| InChIKey | NPVPFRHIPCDFGI-FOCLMDBBSA-N |
| XLogP | 4.97 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|